C27H33FN4O4 — CID 170424733
N-[(1S)-4-[(1-amino-2-fluoroethylidene)amino]-1-(5-cyclopentyl-1,3-oxazol-2-yl)butyl]-3,5-dimethoxynaphthalene-2-carboxamide (PubChem CID 170424733) has the molecular formula C27H33FN4O4 and a molecular weight of 496.58 g/mol. Its IUPAC name is N-[(1S)-4-[(1-amino-2-fluoroethylidene)amino]-1-(5-cyclopentyl-1,3-oxazol-2-yl)butyl]-3,5-dimethoxynaphthalene-2-carboxamide.
| Compound Name | N-[(1S)-4-[(1-amino-2-fluoroethylidene)amino]-1-(5-cyclopentyl-1,3-oxazol-2-yl)butyl]-3,5-dimethoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 170424733 |
| Molecular Formula | C27H33FN4O4 |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | N-[(1S)-4-[(1-amino-2-fluoroethylidene)amino]-1-(5-cyclopentyl-1,3-oxazol-2-yl)butyl]-3,5-dimethoxynaphthalene-2-carboxamide |
| SMILES | COc1cc2c(OC)cccc2cc1C(=O)N[C@@H](CCC/N=C(/N)CF)c1ncc(C2CCCC2)o1 |
| InChI | InChI=1S/C27H33FN4O4/c1-34-22-11-5-9-18-13-20(23(35-2)14-19(18)22)26(33)32-21(10-6-12-30-25(29)15-28)27-31-16-24(36-27)17-7-3-4-8-17/h5,9,11,13-14,16-17,21H,3-4,6-8,10,12,15H2,1-2H3,(H2,29,30)(H,32,33)/t21-/m0/s1 |
| InChIKey | YYTZQSCXWDDXCD-NRFANRHFSA-N |
| XLogP | 5.08 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|