C28H31ClFN3O4 — CID 170425534
N-[(4-chlorophenyl)methyl]-2-[4-(4-fluorophenyl)-2-[(4-methylpiperazin-1-yl)methyl]phenoxy]acetamide;formic acid (PubChem CID 170425534) has the molecular formula C28H31ClFN3O4 and a molecular weight of 528.02 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[4-(4-fluorophenyl)-2-[(4-methylpiperazin-1-yl)methyl]phenoxy]acetamide;formic acid.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[4-(4-fluorophenyl)-2-[(4-methylpiperazin-1-yl)methyl]phenoxy]acetamide;formic acid |
|---|---|
| PubChem CID | 170425534 |
| Molecular Formula | C28H31ClFN3O4 |
| Molecular Weight | 528.02 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[4-(4-fluorophenyl)-2-[(4-methylpiperazin-1-yl)methyl]phenoxy]acetamide;formic acid |
| SMILES | CN1CCN(Cc2cc(-c3ccc(F)cc3)ccc2OCC(=O)NCc2ccc(Cl)cc2)CC1.O=CO |
| InChI | InChI=1S/C27H29ClFN3O2.CH2O2/c1-31-12-14-32(15-13-31)18-23-16-22(21-4-9-25(29)10-5-21)6-11-26(23)34-19-27(33)30-17-20-2-7-24(28)8-3-20;2-1-3/h2-11,16H,12-15,17-19H2,1H3,(H,30,33);1H,(H,2,3) |
| InChIKey | YVZACBBTEBVOEY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.02 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|