C16H22N6 — CID 170425604
2-(azidomethyl)-6-[(4,4-dimethylpiperidin-1-yl)methyl]imidazo[1,2-a]pyridine (PubChem CID 170425604) has the molecular formula C16H22N6 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-(azidomethyl)-6-[(4,4-dimethylpiperidin-1-yl)methyl]imidazo[1,2-a]pyridine.
| Compound Name | 2-(azidomethyl)-6-[(4,4-dimethylpiperidin-1-yl)methyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 170425604 |
| Molecular Formula | C16H22N6 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-(azidomethyl)-6-[(4,4-dimethylpiperidin-1-yl)methyl]imidazo[1,2-a]pyridine |
| SMILES | CC1(C)CCN(Cc2ccc3nc(CN=[N+]=[N-])cn3c2)CC1 |
| InChI | InChI=1S/C16H22N6/c1-16(2)5-7-21(8-6-16)10-13-3-4-15-19-14(9-18-20-17)12-22(15)11-13/h3-4,11-12H,5-10H2,1-2H3 |
| InChIKey | KTAMKQSHJIWVBK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 69.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|