C18H19Cl2N3O3 — CID 170426666
3,4-dichloro-1-(3-hydroxypropoxy)-10-(1H-pyrazol-4-yl)-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-ol (PubChem CID 170426666) has the molecular formula C18H19Cl2N3O3 and a molecular weight of 396.27 g/mol. Its IUPAC name is 3,4-dichloro-1-(3-hydroxypropoxy)-10-(1H-pyrazol-4-yl)-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-ol.
| Compound Name | 3,4-dichloro-1-(3-hydroxypropoxy)-10-(1H-pyrazol-4-yl)-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-ol |
|---|---|
| PubChem CID | 170426666 |
| Molecular Formula | C18H19Cl2N3O3 |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 3,4-dichloro-1-(3-hydroxypropoxy)-10-(1H-pyrazol-4-yl)-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-ol |
| SMILES | OCCCOc1cc(Cl)c(Cl)c2c1c(-c1cn[nH]c1)c1n2CC(O)CC1 |
| InChI | InChI=1S/C18H19Cl2N3O3/c19-12-6-14(26-5-1-4-24)16-15(10-7-21-22-8-10)13-3-2-11(25)9-23(13)18(16)17(12)20/h6-8,11,24-25H,1-5,9H2,(H,21,22) |
| InChIKey | HNFKQWAITDESIP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|