About 3-[[6,7-dichloro-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]cyclobutan-1-ol
3-[[6,7-dichloro-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]cyclobutan-1-ol (PubChem CID 170426667) has the molecular formula C15H13Cl2N3O2
and a molecular weight of 338.19 g/mol. Its IUPAC name is 3-[[6,7-dichloro-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]cyclobutan-1-ol.
Molecular Properties
| Compound Name | 3-[[6,7-dichloro-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]cyclobutan-1-ol |
| PubChem CID | 170426667 |
| Molecular Formula | C15H13Cl2N3O2 |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 3-[[6,7-dichloro-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]cyclobutan-1-ol |
| SMILES | OC1CC(Oc2cc(Cl)c(Cl)c3[nH]cc(-c4cn[nH]c4)c23)C1 |
| InChI | InChI=1S/C15H13Cl2N3O2/c16-11-3-12(22-9-1-8(21)2-9)13-10(7-4-19-20-5-7)6-18-15(13)14(11)17/h3-6,8-9,18,21H,1-2H2,(H,19,20) |
| InChIKey | SWKQKNGBPXOPFP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 73.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[6,7-dichloro-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[6,7-dichloro-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]cyclobutan-1-ol?
The IUPAC name of 3-[[6,7-dichloro-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]cyclobutan-1-ol (CID 170426667) is 3-[[6,7-dichloro-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]cyclobutan-1-ol.
What is the SMILES notation for 3-[[6,7-dichloro-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]cyclobutan-1-ol?
The canonical SMILES for 3-[[6,7-dichloro-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]cyclobutan-1-ol is OC1CC(Oc2cc(Cl)c(Cl)c3[nH]cc(-c4cn[nH]c4)c23)C1.
What is the InChIKey of 3-[[6,7-dichloro-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]cyclobutan-1-ol?
The InChIKey is SWKQKNGBPXOPFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl2N3O2/c16-11-3-12(22-9-1-8(21)2-9)13-10(7-4-19-20-5-7)6-18-15(13)14(11)17/h3-6,8-9,18,21H,1-2H2,(H,19,20).
What are the key properties of 3-[[6,7-dichloro-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]cyclobutan-1-ol?
3-[[6,7-dichloro-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]cyclobutan-1-ol has a molecular weight of 338.19 g/mol, XLogP of 3.77, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[6,7-dichloro-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]cyclobutan-1-ol is sourced from PubChem (CID 170426667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).