About 2-[[6,7-dichloro-2-(hydroxymethyl)-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]acetonitrile
2-[[6,7-dichloro-2-(hydroxymethyl)-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]acetonitrile (PubChem CID 170426724) has the molecular formula C14H10Cl2N4O2
and a molecular weight of 337.17 g/mol. Its IUPAC name is 2-[[6,7-dichloro-2-(hydroxymethyl)-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]acetonitrile.
Molecular Properties
| Compound Name | 2-[[6,7-dichloro-2-(hydroxymethyl)-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]acetonitrile |
| PubChem CID | 170426724 |
| Molecular Formula | C14H10Cl2N4O2 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 2-[[6,7-dichloro-2-(hydroxymethyl)-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]acetonitrile |
| SMILES | N#CCOc1cc(Cl)c(Cl)c2[nH]c(CO)c(-c3cn[nH]c3)c12 |
| InChI | InChI=1S/C14H10Cl2N4O2/c15-8-3-10(22-2-1-17)12-11(7-4-18-19-5-7)9(6-21)20-14(12)13(8)16/h3-5,20-21H,2,6H2,(H,18,19) |
| InChIKey | JKMIJFNFILIGEN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[6,7-dichloro-2-(hydroxymethyl)-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[6,7-dichloro-2-(hydroxymethyl)-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]acetonitrile?
The IUPAC name of 2-[[6,7-dichloro-2-(hydroxymethyl)-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]acetonitrile (CID 170426724) is 2-[[6,7-dichloro-2-(hydroxymethyl)-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]acetonitrile.
What is the SMILES notation for 2-[[6,7-dichloro-2-(hydroxymethyl)-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]acetonitrile?
The canonical SMILES for 2-[[6,7-dichloro-2-(hydroxymethyl)-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]acetonitrile is N#CCOc1cc(Cl)c(Cl)c2[nH]c(CO)c(-c3cn[nH]c3)c12.
What is the InChIKey of 2-[[6,7-dichloro-2-(hydroxymethyl)-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]acetonitrile?
The InChIKey is JKMIJFNFILIGEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2N4O2/c15-8-3-10(22-2-1-17)12-11(7-4-18-19-5-7)9(6-21)20-14(12)13(8)16/h3-5,20-21H,2,6H2,(H,18,19).
What are the key properties of 2-[[6,7-dichloro-2-(hydroxymethyl)-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]acetonitrile?
2-[[6,7-dichloro-2-(hydroxymethyl)-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]acetonitrile has a molecular weight of 337.17 g/mol, XLogP of 3.26, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[6,7-dichloro-2-(hydroxymethyl)-3-(1H-pyrazol-4-yl)-1H-indol-4-yl]oxy]acetonitrile is sourced from PubChem (CID 170426724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).