C13H12Cl2N4 — CID 170426868
[6,7-dichloro-1-methyl-3-(1H-pyrazol-4-yl)indol-2-yl]methanamine (PubChem CID 170426868) has the molecular formula C13H12Cl2N4 and a molecular weight of 295.17 g/mol. Its IUPAC name is [6,7-dichloro-1-methyl-3-(1H-pyrazol-4-yl)indol-2-yl]methanamine.
| Compound Name | [6,7-dichloro-1-methyl-3-(1H-pyrazol-4-yl)indol-2-yl]methanamine |
|---|---|
| PubChem CID | 170426868 |
| Molecular Formula | C13H12Cl2N4 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | [6,7-dichloro-1-methyl-3-(1H-pyrazol-4-yl)indol-2-yl]methanamine |
| SMILES | Cn1c(CN)c(-c2cn[nH]c2)c2ccc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C13H12Cl2N4/c1-19-10(4-16)11(7-5-17-18-6-7)8-2-3-9(14)12(15)13(8)19/h2-3,5-6H,4,16H2,1H3,(H,17,18) |
| InChIKey | JEEYIHRIBZTMEM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |