C20H16Cl2N8O2 — CID 170426915
2-[[6,7-dichloro-2-(1-methyl-1,2,4-triazole-3-carbonyl)-10-(1H-pyrazol-4-yl)-3,4-dihydro-1H-pyrazino[1,2-a]indol-9-yl]oxy]acetonitrile (PubChem CID 170426915) has the molecular formula C20H16Cl2N8O2 and a molecular weight of 471.31 g/mol. Its IUPAC name is 2-[[6,7-dichloro-2-(1-methyl-1,2,4-triazole-3-carbonyl)-10-(1H-pyrazol-4-yl)-3,4-dihydro-1H-pyrazino[1,2-a]indol-9-yl]oxy]acetonitrile.
| Compound Name | 2-[[6,7-dichloro-2-(1-methyl-1,2,4-triazole-3-carbonyl)-10-(1H-pyrazol-4-yl)-3,4-dihydro-1H-pyrazino[1,2-a]indol-9-yl]oxy]acetonitrile |
|---|---|
| PubChem CID | 170426915 |
| Molecular Formula | C20H16Cl2N8O2 |
| Molecular Weight | 471.31 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 2-[[6,7-dichloro-2-(1-methyl-1,2,4-triazole-3-carbonyl)-10-(1H-pyrazol-4-yl)-3,4-dihydro-1H-pyrazino[1,2-a]indol-9-yl]oxy]acetonitrile |
| SMILES | Cn1cnc(C(=O)N2CCn3c(c(-c4cn[nH]c4)c4c(OCC#N)cc(Cl)c(Cl)c43)C2)n1 |
| InChI | InChI=1S/C20H16Cl2N8O2/c1-28-10-24-19(27-28)20(31)29-3-4-30-13(9-29)15(11-7-25-26-8-11)16-14(32-5-2-23)6-12(21)17(22)18(16)30/h6-8,10H,3-5,9H2,1H3,(H,25,26) |
| InChIKey | BGICQOVTXLHPGR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 117.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |