About 2-[(6,7-dichloro-3-imidazol-1-yl-1H-indol-4-yl)oxy]acetonitrile
2-[(6,7-dichloro-3-imidazol-1-yl-1H-indol-4-yl)oxy]acetonitrile (PubChem CID 170427265) has the molecular formula C13H8Cl2N4O
and a molecular weight of 307.14 g/mol. Its IUPAC name is 2-[(6,7-dichloro-3-imidazol-1-yl-1H-indol-4-yl)oxy]acetonitrile.
Molecular Properties
| Compound Name | 2-[(6,7-dichloro-3-imidazol-1-yl-1H-indol-4-yl)oxy]acetonitrile |
| PubChem CID | 170427265 |
| Molecular Formula | C13H8Cl2N4O |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 2-[(6,7-dichloro-3-imidazol-1-yl-1H-indol-4-yl)oxy]acetonitrile |
| SMILES | N#CCOc1cc(Cl)c(Cl)c2[nH]cc(-n3ccnc3)c12 |
| InChI | InChI=1S/C13H8Cl2N4O/c14-8-5-10(20-4-1-16)11-9(19-3-2-17-7-19)6-18-13(11)12(8)15/h2-3,5-7,18H,4H2 |
| InChIKey | XICMNNBRUWYVBY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(6,7-dichloro-3-imidazol-1-yl-1H-indol-4-yl)oxy]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6,7-dichloro-3-imidazol-1-yl-1H-indol-4-yl)oxy]acetonitrile?
The IUPAC name of 2-[(6,7-dichloro-3-imidazol-1-yl-1H-indol-4-yl)oxy]acetonitrile (CID 170427265) is 2-[(6,7-dichloro-3-imidazol-1-yl-1H-indol-4-yl)oxy]acetonitrile.
What is the SMILES notation for 2-[(6,7-dichloro-3-imidazol-1-yl-1H-indol-4-yl)oxy]acetonitrile?
The canonical SMILES for 2-[(6,7-dichloro-3-imidazol-1-yl-1H-indol-4-yl)oxy]acetonitrile is N#CCOc1cc(Cl)c(Cl)c2[nH]cc(-n3ccnc3)c12.
What is the InChIKey of 2-[(6,7-dichloro-3-imidazol-1-yl-1H-indol-4-yl)oxy]acetonitrile?
The InChIKey is XICMNNBRUWYVBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl2N4O/c14-8-5-10(20-4-1-16)11-9(19-3-2-17-7-19)6-18-13(11)12(8)15/h2-3,5-7,18H,4H2.
What are the key properties of 2-[(6,7-dichloro-3-imidazol-1-yl-1H-indol-4-yl)oxy]acetonitrile?
2-[(6,7-dichloro-3-imidazol-1-yl-1H-indol-4-yl)oxy]acetonitrile has a molecular weight of 307.14 g/mol, XLogP of 3.56, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6,7-dichloro-3-imidazol-1-yl-1H-indol-4-yl)oxy]acetonitrile is sourced from PubChem (CID 170427265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).