C10H7Cl2FINO — CID 170427364
6,7-dichloro-4-(2-fluoroethoxy)-3-iodo-1H-indole (PubChem CID 170427364) has the molecular formula C10H7Cl2FINO and a molecular weight of 373.98 g/mol. Its IUPAC name is 6,7-dichloro-4-(2-fluoroethoxy)-3-iodo-1H-indole.
| Compound Name | 6,7-dichloro-4-(2-fluoroethoxy)-3-iodo-1H-indole |
|---|---|
| PubChem CID | 170427364 |
| Molecular Formula | C10H7Cl2FINO |
| Molecular Weight | 373.98 g/mol |
| Exact Mass | 372.89 |
| IUPAC Name | 6,7-dichloro-4-(2-fluoroethoxy)-3-iodo-1H-indole |
| SMILES | FCCOc1cc(Cl)c(Cl)c2[nH]cc(I)c12 |
| InChI | InChI=1S/C10H7Cl2FINO/c11-5-3-7(16-2-1-13)8-6(14)4-15-10(8)9(5)12/h3-4,15H,1-2H2 |
| InChIKey | VBRZZTSJBLOXAX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.98 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|