About 6,7-dichloro-4-(2,2-difluoroethoxy)-1-(4-methylphenyl)sulfonylindole
6,7-dichloro-4-(2,2-difluoroethoxy)-1-(4-methylphenyl)sulfonylindole (PubChem CID 170427426) has the molecular formula C17H13Cl2F2NO3S
and a molecular weight of 420.26 g/mol. Its IUPAC name is 6,7-dichloro-4-(2,2-difluoroethoxy)-1-(4-methylphenyl)sulfonylindole.
Molecular Properties
| Compound Name | 6,7-dichloro-4-(2,2-difluoroethoxy)-1-(4-methylphenyl)sulfonylindole |
| PubChem CID | 170427426 |
| Molecular Formula | C17H13Cl2F2NO3S |
| Molecular Weight | 420.26 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | 6,7-dichloro-4-(2,2-difluoroethoxy)-1-(4-methylphenyl)sulfonylindole |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(OCC(F)F)cc(Cl)c(Cl)c32)cc1 |
| InChI | InChI=1S/C17H13Cl2F2NO3S/c1-10-2-4-11(5-3-10)26(23,24)22-7-6-12-14(25-9-15(20)21)8-13(18)16(19)17(12)22/h2-8,15H,9H2,1H3 |
| InChIKey | ORMUGAIBEQJQKH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.26 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,7-dichloro-4-(2,2-difluoroethoxy)-1-(4-methylphenyl)sulfonylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dichloro-4-(2,2-difluoroethoxy)-1-(4-methylphenyl)sulfonylindole?
The IUPAC name of 6,7-dichloro-4-(2,2-difluoroethoxy)-1-(4-methylphenyl)sulfonylindole (CID 170427426) is 6,7-dichloro-4-(2,2-difluoroethoxy)-1-(4-methylphenyl)sulfonylindole.
What is the SMILES notation for 6,7-dichloro-4-(2,2-difluoroethoxy)-1-(4-methylphenyl)sulfonylindole?
The canonical SMILES for 6,7-dichloro-4-(2,2-difluoroethoxy)-1-(4-methylphenyl)sulfonylindole is Cc1ccc(S(=O)(=O)n2ccc3c(OCC(F)F)cc(Cl)c(Cl)c32)cc1.
What is the InChIKey of 6,7-dichloro-4-(2,2-difluoroethoxy)-1-(4-methylphenyl)sulfonylindole?
The InChIKey is ORMUGAIBEQJQKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13Cl2F2NO3S/c1-10-2-4-11(5-3-10)26(23,24)22-7-6-12-14(25-9-15(20)21)8-13(18)16(19)17(12)22/h2-8,15H,9H2,1H3.
What are the key properties of 6,7-dichloro-4-(2,2-difluoroethoxy)-1-(4-methylphenyl)sulfonylindole?
6,7-dichloro-4-(2,2-difluoroethoxy)-1-(4-methylphenyl)sulfonylindole has a molecular weight of 420.26 g/mol, XLogP of 5.14, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dichloro-4-(2,2-difluoroethoxy)-1-(4-methylphenyl)sulfonylindole is sourced from PubChem (CID 170427426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).