About [6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1H-indol-2-yl]methylurea
[6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1H-indol-2-yl]methylurea (PubChem CID 170427525) has the molecular formula C18H19Cl2N5O2
and a molecular weight of 408.29 g/mol. Its IUPAC name is [6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1H-indol-2-yl]methylurea.
Molecular Properties
| Compound Name | [6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1H-indol-2-yl]methylurea |
| PubChem CID | 170427525 |
| Molecular Formula | C18H19Cl2N5O2 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | [6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1H-indol-2-yl]methylurea |
| SMILES | NC(=O)NCc1[nH]c2c(Cl)c(Cl)ccc2c1-c1cnn(C2CCCCO2)c1 |
| InChI | InChI=1S/C18H19Cl2N5O2/c19-12-5-4-11-15(13(8-22-18(21)26)24-17(11)16(12)20)10-7-23-25(9-10)14-3-1-2-6-27-14/h4-5,7,9,14,24H,1-3,6,8H2,(H3,21,22,26) |
| InChIKey | ZWBMPESILBFINN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1H-indol-2-yl]methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1H-indol-2-yl]methylurea?
The IUPAC name of [6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1H-indol-2-yl]methylurea (CID 170427525) is [6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1H-indol-2-yl]methylurea.
What is the SMILES notation for [6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1H-indol-2-yl]methylurea?
The canonical SMILES for [6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1H-indol-2-yl]methylurea is NC(=O)NCc1[nH]c2c(Cl)c(Cl)ccc2c1-c1cnn(C2CCCCO2)c1.
What is the InChIKey of [6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1H-indol-2-yl]methylurea?
The InChIKey is ZWBMPESILBFINN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19Cl2N5O2/c19-12-5-4-11-15(13(8-22-18(21)26)24-17(11)16(12)20)10-7-23-25(9-10)14-3-1-2-6-27-14/h4-5,7,9,14,24H,1-3,6,8H2,(H3,21,22,26).
What are the key properties of [6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1H-indol-2-yl]methylurea?
[6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1H-indol-2-yl]methylurea has a molecular weight of 408.29 g/mol, XLogP of 4.21, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]-1H-indol-2-yl]methylurea is sourced from PubChem (CID 170427525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).