C12H11BrCl2N4S — CID 170427752
9-bromo-6,7-dichloro-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carbothiohydrazide (PubChem CID 170427752) has the molecular formula C12H11BrCl2N4S and a molecular weight of 394.13 g/mol. Its IUPAC name is 9-bromo-6,7-dichloro-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carbothiohydrazide.
| Compound Name | 9-bromo-6,7-dichloro-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carbothiohydrazide |
|---|---|
| PubChem CID | 170427752 |
| Molecular Formula | C12H11BrCl2N4S |
| Molecular Weight | 394.13 g/mol |
| Exact Mass | 391.93 |
| IUPAC Name | 9-bromo-6,7-dichloro-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carbothiohydrazide |
| SMILES | NNC(=S)N1CCn2c(cc3c(Br)cc(Cl)c(Cl)c32)C1 |
| InChI | InChI=1S/C12H11BrCl2N4S/c13-8-4-9(14)10(15)11-7(8)3-6-5-18(12(20)17-16)1-2-19(6)11/h3-4H,1-2,5,16H2,(H,17,20) |
| InChIKey | ZUZSTNZFNCCAGH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.13 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|