C16H15ClN6O2 — CID 170427791
2-[4-[6-chloro-4-methoxy-3-(1H-pyrazol-4-yl)indol-1-yl]triazol-1-yl]ethanol (PubChem CID 170427791) has the molecular formula C16H15ClN6O2 and a molecular weight of 358.79 g/mol. Its IUPAC name is 2-[4-[6-chloro-4-methoxy-3-(1H-pyrazol-4-yl)indol-1-yl]triazol-1-yl]ethanol.
| Compound Name | 2-[4-[6-chloro-4-methoxy-3-(1H-pyrazol-4-yl)indol-1-yl]triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 170427791 |
| Molecular Formula | C16H15ClN6O2 |
| Molecular Weight | 358.79 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 2-[4-[6-chloro-4-methoxy-3-(1H-pyrazol-4-yl)indol-1-yl]triazol-1-yl]ethanol |
| SMILES | COc1cc(Cl)cc2c1c(-c1cn[nH]c1)cn2-c1cn(CCO)nn1 |
| InChI | InChI=1S/C16H15ClN6O2/c1-25-14-5-11(17)4-13-16(14)12(10-6-18-19-7-10)8-23(13)15-9-22(2-3-24)21-20-15/h4-9,24H,2-3H2,1H3,(H,18,19) |
| InChIKey | AFEFNJYLWDGGGG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.79 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |