About 1-[3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-fluorophenyl]ethanone
1-[3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-fluorophenyl]ethanone (PubChem CID 170428458) has the molecular formula C10H12FNO2S
and a molecular weight of 229.28 g/mol. Its IUPAC name is 1-[3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-fluorophenyl]ethanone.
Molecular Properties
| Compound Name | 1-[3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-fluorophenyl]ethanone |
| PubChem CID | 170428458 |
| Molecular Formula | C10H12FNO2S |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 1-[3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-fluorophenyl]ethanone |
| SMILES | CC(=O)c1cccc(N=S(C)(C)=O)c1F |
| InChI | InChI=1S/C10H12FNO2S/c1-7(13)8-5-4-6-9(10(8)11)12-15(2,3)14/h4-6H,1-3H3 |
| InChIKey | VDVGKTAZKJEMQB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-fluorophenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-fluorophenyl]ethanone?
The IUPAC name of 1-[3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-fluorophenyl]ethanone (CID 170428458) is 1-[3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-fluorophenyl]ethanone.
What is the SMILES notation for 1-[3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-fluorophenyl]ethanone?
The canonical SMILES for 1-[3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-fluorophenyl]ethanone is CC(=O)c1cccc(N=S(C)(C)=O)c1F.
What is the InChIKey of 1-[3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-fluorophenyl]ethanone?
The InChIKey is VDVGKTAZKJEMQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FNO2S/c1-7(13)8-5-4-6-9(10(8)11)12-15(2,3)14/h4-6H,1-3H3.
What are the key properties of 1-[3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-fluorophenyl]ethanone?
1-[3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-fluorophenyl]ethanone has a molecular weight of 229.28 g/mol, XLogP of 2.39, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-fluorophenyl]ethanone is sourced from PubChem (CID 170428458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).