C21H17F3N6O2 — CID 170429702
1,4-dimethyl-N-[(5S)-2-(trifluoromethyl)-6,8-dihydro-5H-pyrano[3,4-b]pyridin-5-yl]pyrazolo[3,4-c][1,7]naphthyridine-3-carboxamide (PubChem CID 170429702) has the molecular formula C21H17F3N6O2 and a molecular weight of 442.40 g/mol. Its IUPAC name is 1,4-dimethyl-N-[(5S)-2-(trifluoromethyl)-6,8-dihydro-5H-pyrano[3,4-b]pyridin-5-yl]pyrazolo[3,4-c][1,7]naphthyridine-3-carboxamide.
| Compound Name | 1,4-dimethyl-N-[(5S)-2-(trifluoromethyl)-6,8-dihydro-5H-pyrano[3,4-b]pyridin-5-yl]pyrazolo[3,4-c][1,7]naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 170429702 |
| Molecular Formula | C21H17F3N6O2 |
| Molecular Weight | 442.40 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 1,4-dimethyl-N-[(5S)-2-(trifluoromethyl)-6,8-dihydro-5H-pyrano[3,4-b]pyridin-5-yl]pyrazolo[3,4-c][1,7]naphthyridine-3-carboxamide |
| SMILES | Cc1nn(C(=O)N[C@@H]2COCc3nc(C(F)(F)F)ccc32)c2c(C)nc3cnccc3c12 |
| InChI | InChI=1S/C21H17F3N6O2/c1-10-18-13-5-6-25-7-14(13)26-11(2)19(18)30(29-10)20(31)28-16-9-32-8-15-12(16)3-4-17(27-15)21(22,23)24/h3-7,16H,8-9H2,1-2H3,(H,28,31)/t16-/m1/s1 |
| InChIKey | IPCVLISXDSCXMM-MRXNPFEDSA-N |
| XLogP | 3.84 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |