About 1-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)cyclohexane-1-carbonitrile
1-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)cyclohexane-1-carbonitrile (PubChem CID 170430806) has the molecular formula C12H14ClN5S
and a molecular weight of 295.80 g/mol. Its IUPAC name is 1-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)cyclohexane-1-carbonitrile.
Molecular Properties
| Compound Name | 1-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)cyclohexane-1-carbonitrile |
| PubChem CID | 170430806 |
| Molecular Formula | C12H14ClN5S |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 1-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)cyclohexane-1-carbonitrile |
| SMILES | N#CC1(N2c3nc(Cl)ncc3NC2S)CCCCC1 |
| InChI | InChI=1S/C12H14ClN5S/c13-10-15-6-8-9(17-10)18(11(19)16-8)12(7-14)4-2-1-3-5-12/h6,11,16,19H,1-5H2 |
| InChIKey | GXNWPWRYQXMUQZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)cyclohexane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)cyclohexane-1-carbonitrile?
The IUPAC name of 1-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)cyclohexane-1-carbonitrile (CID 170430806) is 1-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)cyclohexane-1-carbonitrile.
What is the SMILES notation for 1-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)cyclohexane-1-carbonitrile?
The canonical SMILES for 1-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)cyclohexane-1-carbonitrile is N#CC1(N2c3nc(Cl)ncc3NC2S)CCCCC1.
What is the InChIKey of 1-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)cyclohexane-1-carbonitrile?
The InChIKey is GXNWPWRYQXMUQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN5S/c13-10-15-6-8-9(17-10)18(11(19)16-8)12(7-14)4-2-1-3-5-12/h6,11,16,19H,1-5H2.
What are the key properties of 1-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)cyclohexane-1-carbonitrile?
1-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)cyclohexane-1-carbonitrile has a molecular weight of 295.80 g/mol, XLogP of 2.80, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)cyclohexane-1-carbonitrile is sourced from PubChem (CID 170430806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).