C21H25N7O2 — CID 170430895
6-methyl-3-[[8-[(2R)-2-methylmorpholin-2-yl]pyrido[3,4-d]pyrimidin-2-yl]amino]-1,5,7,8-tetrahydro-1,6-naphthyridin-2-one (PubChem CID 170430895) has the molecular formula C21H25N7O2 and a molecular weight of 407.48 g/mol. Its IUPAC name is 6-methyl-3-[[8-[(2R)-2-methylmorpholin-2-yl]pyrido[3,4-d]pyrimidin-2-yl]amino]-1,5,7,8-tetrahydro-1,6-naphthyridin-2-one.
| Compound Name | 6-methyl-3-[[8-[(2R)-2-methylmorpholin-2-yl]pyrido[3,4-d]pyrimidin-2-yl]amino]-1,5,7,8-tetrahydro-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 170430895 |
| Molecular Formula | C21H25N7O2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 6-methyl-3-[[8-[(2R)-2-methylmorpholin-2-yl]pyrido[3,4-d]pyrimidin-2-yl]amino]-1,5,7,8-tetrahydro-1,6-naphthyridin-2-one |
| SMILES | CN1CCc2[nH]c(=O)c(Nc3ncc4ccnc([C@@]5(C)CNCCO5)c4n3)cc2C1 |
| InChI | InChI=1S/C21H25N7O2/c1-21(12-22-6-8-30-21)18-17-13(3-5-23-18)10-24-20(27-17)26-16-9-14-11-28(2)7-4-15(14)25-19(16)29/h3,5,9-10,22H,4,6-8,11-12H2,1-2H3,(H,25,29)(H,24,26,27)/t21-/m1/s1 |
| InChIKey | JZQVQOVYOQATLX-OAQYLSRUSA-N |
| XLogP | 1.28 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |