About 4-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)thiane-4-carbonitrile
4-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)thiane-4-carbonitrile (PubChem CID 170430943) has the molecular formula C11H12ClN5S2
and a molecular weight of 313.84 g/mol. Its IUPAC name is 4-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)thiane-4-carbonitrile.
Molecular Properties
| Compound Name | 4-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)thiane-4-carbonitrile |
| PubChem CID | 170430943 |
| Molecular Formula | C11H12ClN5S2 |
| Molecular Weight | 313.84 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 4-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)thiane-4-carbonitrile |
| SMILES | N#CC1(N2c3nc(Cl)ncc3NC2S)CCSCC1 |
| InChI | InChI=1S/C11H12ClN5S2/c12-9-14-5-7-8(16-9)17(10(18)15-7)11(6-13)1-3-19-4-2-11/h5,10,15,18H,1-4H2 |
| InChIKey | JLRULRLAIBVXLP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.84 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)thiane-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)thiane-4-carbonitrile?
The IUPAC name of 4-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)thiane-4-carbonitrile (CID 170430943) is 4-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)thiane-4-carbonitrile.
What is the SMILES notation for 4-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)thiane-4-carbonitrile?
The canonical SMILES for 4-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)thiane-4-carbonitrile is N#CC1(N2c3nc(Cl)ncc3NC2S)CCSCC1.
What is the InChIKey of 4-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)thiane-4-carbonitrile?
The InChIKey is JLRULRLAIBVXLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN5S2/c12-9-14-5-7-8(16-9)17(10(18)15-7)11(6-13)1-3-19-4-2-11/h5,10,15,18H,1-4H2.
What are the key properties of 4-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)thiane-4-carbonitrile?
4-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)thiane-4-carbonitrile has a molecular weight of 313.84 g/mol, XLogP of 2.36, 1 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloro-8-sulfanyl-7,8-dihydropurin-9-yl)thiane-4-carbonitrile is sourced from PubChem (CID 170430943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).