C16H16Cl3F2N3O2 — CID 170431017
2,2,2-trichloroethyl N-[3-tert-butyl-1-(2,4-difluorophenyl)pyrazol-5-yl]carbamate (PubChem CID 170431017) has the molecular formula C16H16Cl3F2N3O2 and a molecular weight of 426.68 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[3-tert-butyl-1-(2,4-difluorophenyl)pyrazol-5-yl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[3-tert-butyl-1-(2,4-difluorophenyl)pyrazol-5-yl]carbamate |
|---|---|
| PubChem CID | 170431017 |
| Molecular Formula | C16H16Cl3F2N3O2 |
| Molecular Weight | 426.68 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | 2,2,2-trichloroethyl N-[3-tert-butyl-1-(2,4-difluorophenyl)pyrazol-5-yl]carbamate |
| SMILES | CC(C)(C)c1cc(NC(=O)OCC(Cl)(Cl)Cl)n(-c2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C16H16Cl3F2N3O2/c1-15(2,3)12-7-13(22-14(25)26-8-16(17,18)19)24(23-12)11-5-4-9(20)6-10(11)21/h4-7H,8H2,1-3H3,(H,22,25) |
| InChIKey | NWXKSYSTHVHSAL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.68 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|