About dioctyl 2-[6-(5-hydroxypentylamino)hexyl]-2-methylpropanedioate
dioctyl 2-[6-(5-hydroxypentylamino)hexyl]-2-methylpropanedioate (PubChem CID 170431409) has the molecular formula C31H61NO5
and a molecular weight of 527.83 g/mol. Its IUPAC name is dioctyl 2-[6-(5-hydroxypentylamino)hexyl]-2-methylpropanedioate.
Molecular Properties
| Compound Name | dioctyl 2-[6-(5-hydroxypentylamino)hexyl]-2-methylpropanedioate |
| PubChem CID | 170431409 |
| Molecular Formula | C31H61NO5 |
| Molecular Weight | 527.83 g/mol |
| Exact Mass | 527.45 |
| IUPAC Name | dioctyl 2-[6-(5-hydroxypentylamino)hexyl]-2-methylpropanedioate |
| SMILES | CCCCCCCCOC(=O)C(C)(CCCCCCNCCCCCO)C(=O)OCCCCCCCC |
| InChI | InChI=1S/C31H61NO5/c1-4-6-8-10-14-21-27-36-29(34)31(3,30(35)37-28-22-15-11-9-7-5-2)23-17-12-13-18-24-32-25-19-16-20-26-33/h32-33H,4-28H2,1-3H3 |
| InChIKey | JJMJPWUHZUDGPO-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 527.83 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dioctyl 2-[6-(5-hydroxypentylamino)hexyl]-2-methylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioctyl 2-[6-(5-hydroxypentylamino)hexyl]-2-methylpropanedioate?
The IUPAC name of dioctyl 2-[6-(5-hydroxypentylamino)hexyl]-2-methylpropanedioate (CID 170431409) is dioctyl 2-[6-(5-hydroxypentylamino)hexyl]-2-methylpropanedioate.
What is the SMILES notation for dioctyl 2-[6-(5-hydroxypentylamino)hexyl]-2-methylpropanedioate?
The canonical SMILES for dioctyl 2-[6-(5-hydroxypentylamino)hexyl]-2-methylpropanedioate is CCCCCCCCOC(=O)C(C)(CCCCCCNCCCCCO)C(=O)OCCCCCCCC.
What is the InChIKey of dioctyl 2-[6-(5-hydroxypentylamino)hexyl]-2-methylpropanedioate?
The InChIKey is JJMJPWUHZUDGPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H61NO5/c1-4-6-8-10-14-21-27-36-29(34)31(3,30(35)37-28-22-15-11-9-7-5-2)23-17-12-13-18-24-32-25-19-16-20-26-33/h32-33H,4-28H2,1-3H3.
What are the key properties of dioctyl 2-[6-(5-hydroxypentylamino)hexyl]-2-methylpropanedioate?
dioctyl 2-[6-(5-hydroxypentylamino)hexyl]-2-methylpropanedioate has a molecular weight of 527.83 g/mol, XLogP of 7.50, 28 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dioctyl 2-[6-(5-hydroxypentylamino)hexyl]-2-methylpropanedioate is sourced from PubChem (CID 170431409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).