About [5-[2,4-difluoro-3-[(4-methoxyphenyl)methoxy]phenyl]-1,2-oxazol-3-yl]methanol
[5-[2,4-difluoro-3-[(4-methoxyphenyl)methoxy]phenyl]-1,2-oxazol-3-yl]methanol (PubChem CID 170431668) has the molecular formula C18H15F2NO4
and a molecular weight of 347.32 g/mol. Its IUPAC name is [5-[2,4-difluoro-3-[(4-methoxyphenyl)methoxy]phenyl]-1,2-oxazol-3-yl]methanol.
Molecular Properties
| Compound Name | [5-[2,4-difluoro-3-[(4-methoxyphenyl)methoxy]phenyl]-1,2-oxazol-3-yl]methanol |
| PubChem CID | 170431668 |
| Molecular Formula | C18H15F2NO4 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | [5-[2,4-difluoro-3-[(4-methoxyphenyl)methoxy]phenyl]-1,2-oxazol-3-yl]methanol |
| SMILES | COc1ccc(COc2c(F)ccc(-c3cc(CO)no3)c2F)cc1 |
| InChI | InChI=1S/C18H15F2NO4/c1-23-13-4-2-11(3-5-13)10-24-18-15(19)7-6-14(17(18)20)16-8-12(9-22)21-25-16/h2-8,22H,9-10H2,1H3 |
| InChIKey | VFOAPPDNBRFGLF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-[2,4-difluoro-3-[(4-methoxyphenyl)methoxy]phenyl]-1,2-oxazol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[2,4-difluoro-3-[(4-methoxyphenyl)methoxy]phenyl]-1,2-oxazol-3-yl]methanol?
The IUPAC name of [5-[2,4-difluoro-3-[(4-methoxyphenyl)methoxy]phenyl]-1,2-oxazol-3-yl]methanol (CID 170431668) is [5-[2,4-difluoro-3-[(4-methoxyphenyl)methoxy]phenyl]-1,2-oxazol-3-yl]methanol.
What is the SMILES notation for [5-[2,4-difluoro-3-[(4-methoxyphenyl)methoxy]phenyl]-1,2-oxazol-3-yl]methanol?
The canonical SMILES for [5-[2,4-difluoro-3-[(4-methoxyphenyl)methoxy]phenyl]-1,2-oxazol-3-yl]methanol is COc1ccc(COc2c(F)ccc(-c3cc(CO)no3)c2F)cc1.
What is the InChIKey of [5-[2,4-difluoro-3-[(4-methoxyphenyl)methoxy]phenyl]-1,2-oxazol-3-yl]methanol?
The InChIKey is VFOAPPDNBRFGLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F2NO4/c1-23-13-4-2-11(3-5-13)10-24-18-15(19)7-6-14(17(18)20)16-8-12(9-22)21-25-16/h2-8,22H,9-10H2,1H3.
What are the key properties of [5-[2,4-difluoro-3-[(4-methoxyphenyl)methoxy]phenyl]-1,2-oxazol-3-yl]methanol?
[5-[2,4-difluoro-3-[(4-methoxyphenyl)methoxy]phenyl]-1,2-oxazol-3-yl]methanol has a molecular weight of 347.32 g/mol, XLogP of 3.70, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[2,4-difluoro-3-[(4-methoxyphenyl)methoxy]phenyl]-1,2-oxazol-3-yl]methanol is sourced from PubChem (CID 170431668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).