C40H42Cl2N2O9S3 — CID 170431857
3-[2-[[2-(1-benzofuran-6-carbonyl)-5,7-dichloro-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-(3-methylsulfonylphenyl)propanoyl]oxypropyl 5-(dithiolan-3-yl)pentanoate (PubChem CID 170431857) has the molecular formula C40H42Cl2N2O9S3 and a molecular weight of 861.89 g/mol. Its IUPAC name is 3-[2-[[2-(1-benzofuran-6-carbonyl)-5,7-dichloro-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-(3-methylsulfonylphenyl)propanoyl]oxypropyl 5-(dithiolan-3-yl)pentanoate.
| Compound Name | 3-[2-[[2-(1-benzofuran-6-carbonyl)-5,7-dichloro-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-(3-methylsulfonylphenyl)propanoyl]oxypropyl 5-(dithiolan-3-yl)pentanoate |
|---|---|
| PubChem CID | 170431857 |
| Molecular Formula | C40H42Cl2N2O9S3 |
| Molecular Weight | 861.89 g/mol |
| Exact Mass | 860.14 |
| IUPAC Name | 3-[2-[[2-(1-benzofuran-6-carbonyl)-5,7-dichloro-3,4-dihydro-1H-isoquinoline-6-carbonyl]amino]-3-(3-methylsulfonylphenyl)propanoyl]oxypropyl 5-(dithiolan-3-yl)pentanoate |
| SMILES | CS(=O)(=O)c1cccc(CC(NC(=O)c2c(Cl)cc3c(c2Cl)CCN(C(=O)c2ccc4ccoc4c2)C3)C(=O)OCCCOC(=O)CCCCC2CCSS2)c1 |
| InChI | InChI=1S/C40H42Cl2N2O9S3/c1-56(49,50)30-8-4-6-25(20-30)21-33(40(48)53-17-5-16-52-35(45)9-3-2-7-29-14-19-54-55-29)43-38(46)36-32(41)22-28-24-44(15-12-31(28)37(36)42)39(47)27-11-10-26-13-18-51-34(26)23-27/h4,6,8,10-11,13,18,20,22-23,29,33H,2-3,5,7,9,12,14-17,19,21,24H2,1H3,(H,43,46) |
| InChIKey | MTJBXMAUTIQBPL-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 149.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.89 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|