C29H31F6N11 — CID 170432926
2-[4-[(2S,5R)-4-[bis[5-(trifluoromethyl)-2-pyridinyl]methyl]-2,5-dimethylpiperazin-1-yl]-[1,2,4]triazolo[3,4-b]purin-1-yl]-N,N-dimethylethanamine (PubChem CID 170432926) has the molecular formula C29H31F6N11 and a molecular weight of 647.63 g/mol. Its IUPAC name is 2-[4-[(2S,5R)-4-[bis[5-(trifluoromethyl)-2-pyridinyl]methyl]-2,5-dimethylpiperazin-1-yl]-[1,2,4]triazolo[3,4-b]purin-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[(2S,5R)-4-[bis[5-(trifluoromethyl)-2-pyridinyl]methyl]-2,5-dimethylpiperazin-1-yl]-[1,2,4]triazolo[3,4-b]purin-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 170432926 |
| Molecular Formula | C29H31F6N11 |
| Molecular Weight | 647.63 g/mol |
| Exact Mass | 647.27 |
| IUPAC Name | 2-[4-[(2S,5R)-4-[bis[5-(trifluoromethyl)-2-pyridinyl]methyl]-2,5-dimethylpiperazin-1-yl]-[1,2,4]triazolo[3,4-b]purin-1-yl]-N,N-dimethylethanamine |
| SMILES | C[C@@H]1CN(c2nc3nncn3c3c2ncn3CCN(C)C)[C@@H](C)CN1C(c1ccc(C(F)(F)F)cn1)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C29H31F6N11/c1-17-14-45(25-23-26(46-16-39-41-27(46)40-25)43(15-38-23)10-9-42(3)4)18(2)13-44(17)24(21-7-5-19(11-36-21)28(30,31)32)22-8-6-20(12-37-22)29(33,34)35/h5-8,11-12,15-18,24H,9-10,13-14H2,1-4H3/t17-,18+/m1/s1 |
| InChIKey | LHEZNLMCYDAPTO-MSOLQXFVSA-N |
| XLogP | 4.55 |
| TPSA | 96.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.63 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |