C29H37F3N8O — CID 170433190
4-[(2S,5R)-4-[1-[4-(difluoromethyl)-3-fluorophenyl]-2-methylpropyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine (PubChem CID 170433190) has the molecular formula C29H37F3N8O and a molecular weight of 570.66 g/mol. Its IUPAC name is 4-[(2S,5R)-4-[1-[4-(difluoromethyl)-3-fluorophenyl]-2-methylpropyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine.
| Compound Name | 4-[(2S,5R)-4-[1-[4-(difluoromethyl)-3-fluorophenyl]-2-methylpropyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine |
|---|---|
| PubChem CID | 170433190 |
| Molecular Formula | C29H37F3N8O |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | 4-[(2S,5R)-4-[1-[4-(difluoromethyl)-3-fluorophenyl]-2-methylpropyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine |
| SMILES | Cc1nc2c(N3C[C@@H](C)N(C(c4ccc(C(F)F)c(F)c4)C(C)C)C[C@@H]3C)nc3nncn3c2n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C29H37F3N8O/c1-16(2)25(20-8-9-22(26(31)32)23(30)11-20)37-12-18(4)38(13-17(37)3)27-24-28(40-15-33-36-29(40)35-27)39(19(5)34-24)14-21-7-6-10-41-21/h8-9,11,15-18,21,25-26H,6-7,10,12-14H2,1-5H3/t17-,18+,21+,25?/m1/s1 |
| InChIKey | BKRQLVPXCYWRDD-INRZHKRWSA-N |
| XLogP | 5.33 |
| TPSA | 76.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |