C25H27N5O2 — CID 170433279
5-[1-methyl-7-(2-methylpiperazin-1-yl)indazol-3-yl]-6-phenylmethoxy-1H-pyridin-2-one (PubChem CID 170433279) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is 5-[1-methyl-7-(2-methylpiperazin-1-yl)indazol-3-yl]-6-phenylmethoxy-1H-pyridin-2-one.
| Compound Name | 5-[1-methyl-7-(2-methylpiperazin-1-yl)indazol-3-yl]-6-phenylmethoxy-1H-pyridin-2-one |
|---|---|
| PubChem CID | 170433279 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 5-[1-methyl-7-(2-methylpiperazin-1-yl)indazol-3-yl]-6-phenylmethoxy-1H-pyridin-2-one |
| SMILES | CC1CNCCN1c1cccc2c(-c3ccc(=O)[nH]c3OCc3ccccc3)nn(C)c12 |
| InChI | InChI=1S/C25H27N5O2/c1-17-15-26-13-14-30(17)21-10-6-9-19-23(28-29(2)24(19)21)20-11-12-22(31)27-25(20)32-16-18-7-4-3-5-8-18/h3-12,17,26H,13-16H2,1-2H3,(H,27,31) |
| InChIKey | UCIVGTUCNKPLEK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |