C35H38N4O5S — CID 170433300
2-[1-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1-methylindazol-7-yl]piperidin-4-yl]ethyl methanesulfonate (PubChem CID 170433300) has the molecular formula C35H38N4O5S and a molecular weight of 626.78 g/mol. Its IUPAC name is 2-[1-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1-methylindazol-7-yl]piperidin-4-yl]ethyl methanesulfonate.
| Compound Name | 2-[1-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1-methylindazol-7-yl]piperidin-4-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 170433300 |
| Molecular Formula | C35H38N4O5S |
| Molecular Weight | 626.78 g/mol |
| Exact Mass | 626.26 |
| IUPAC Name | 2-[1-[3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-1-methylindazol-7-yl]piperidin-4-yl]ethyl methanesulfonate |
| SMILES | Cn1nc(-c2ccc(OCc3ccccc3)nc2OCc2ccccc2)c2cccc(N3CCC(CCOS(C)(=O)=O)CC3)c21 |
| InChI | InChI=1S/C35H38N4O5S/c1-38-34-29(14-9-15-31(34)39-21-18-26(19-22-39)20-23-44-45(2,40)41)33(37-38)30-16-17-32(42-24-27-10-5-3-6-11-27)36-35(30)43-25-28-12-7-4-8-13-28/h3-17,26H,18-25H2,1-2H3 |
| InChIKey | PVZPPNJBJQJOCT-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.78 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|