C31H34F2N8O — CID 170433415
4-[(2S,5R)-4-[bis(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine (PubChem CID 170433415) has the molecular formula C31H34F2N8O and a molecular weight of 572.66 g/mol. Its IUPAC name is 4-[(2S,5R)-4-[bis(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine.
| Compound Name | 4-[(2S,5R)-4-[bis(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine |
|---|---|
| PubChem CID | 170433415 |
| Molecular Formula | C31H34F2N8O |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | 4-[(2S,5R)-4-[bis(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine |
| SMILES | Cc1nc2c(N3C[C@@H](C)N(C(c4ccc(F)cc4)c4ccc(F)cc4)C[C@@H]3C)nc3nncn3c2n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C31H34F2N8O/c1-19-16-39(20(2)15-38(19)28(22-6-10-24(32)11-7-22)23-8-12-25(33)13-9-23)29-27-30(41-18-34-37-31(41)36-29)40(21(3)35-27)17-26-5-4-14-42-26/h6-13,18-20,26,28H,4-5,14-17H2,1-3H3/t19-,20+,26+/m1/s1 |
| InChIKey | HQCPFDUOFWFXTJ-GOHWNWGWSA-N |
| XLogP | 4.93 |
| TPSA | 76.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |