C30H31F4N9O2 — CID 170433480
4-[(2S,5R)-4-[(R)-(4-fluorophenyl)-[5-(trifluoromethoxy)-2-pyridinyl]methyl]-2,5-dimethylpiperazin-1-yl]-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine (PubChem CID 170433480) has the molecular formula C30H31F4N9O2 and a molecular weight of 625.63 g/mol. Its IUPAC name is 4-[(2S,5R)-4-[(R)-(4-fluorophenyl)-[5-(trifluoromethoxy)-2-pyridinyl]methyl]-2,5-dimethylpiperazin-1-yl]-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine.
| Compound Name | 4-[(2S,5R)-4-[(R)-(4-fluorophenyl)-[5-(trifluoromethoxy)-2-pyridinyl]methyl]-2,5-dimethylpiperazin-1-yl]-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine |
|---|---|
| PubChem CID | 170433480 |
| Molecular Formula | C30H31F4N9O2 |
| Molecular Weight | 625.63 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | 4-[(2S,5R)-4-[(R)-(4-fluorophenyl)-[5-(trifluoromethoxy)-2-pyridinyl]methyl]-2,5-dimethylpiperazin-1-yl]-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine |
| SMILES | C[C@@H]1CN(c2nc3nncn3c3c2ncn3C[C@@H]2CCCO2)[C@@H](C)CN1C(c1ccc(F)cc1)c1ccc(OC(F)(F)F)cn1 |
| InChI | InChI=1S/C30H31F4N9O2/c1-18-14-42(27-25-28(43-17-37-39-29(43)38-27)40(16-36-25)15-23-4-3-11-44-23)19(2)13-41(18)26(20-5-7-21(31)8-6-20)24-10-9-22(12-35-24)45-30(32,33)34/h5-10,12,16-19,23,26H,3-4,11,13-15H2,1-2H3/t18-,19+,23+,26?/m1/s1 |
| InChIKey | LIWMKOUTZVECFD-BEFOLLFYSA-N |
| XLogP | 4.77 |
| TPSA | 98.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.63 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |