C26H33FN8 — CID 170433600
1-(cyclopropylmethyl)-4-[(2S,5R)-4-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]-2,5-dimethylpiperazin-1-yl]-[1,2,4]triazolo[3,4-b]purine (PubChem CID 170433600) has the molecular formula C26H33FN8 and a molecular weight of 476.60 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-4-[(2S,5R)-4-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]-2,5-dimethylpiperazin-1-yl]-[1,2,4]triazolo[3,4-b]purine.
| Compound Name | 1-(cyclopropylmethyl)-4-[(2S,5R)-4-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]-2,5-dimethylpiperazin-1-yl]-[1,2,4]triazolo[3,4-b]purine |
|---|---|
| PubChem CID | 170433600 |
| Molecular Formula | C26H33FN8 |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | 1-(cyclopropylmethyl)-4-[(2S,5R)-4-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]-2,5-dimethylpiperazin-1-yl]-[1,2,4]triazolo[3,4-b]purine |
| SMILES | CC(C)[C@H](c1ccc(F)cc1)N1C[C@H](C)N(c2nc3nncn3c3c2ncn3CC2CC2)C[C@H]1C |
| InChI | InChI=1S/C26H33FN8/c1-16(2)23(20-7-9-21(27)10-8-20)33-11-18(4)34(12-17(33)3)24-22-25(35-15-29-31-26(35)30-24)32(14-28-22)13-19-5-6-19/h7-10,14-19,23H,5-6,11-13H2,1-4H3/t17-,18+,23-/m1/s1 |
| InChIKey | BQEWVZLWHCBCNG-IEGUWTFLSA-N |
| XLogP | 4.32 |
| TPSA | 67.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |