C18H19F2N3O4 — CID 170433637
2-cyclopropyl-3,3-difluoro-10-nitro-7-propan-2-yl-2,4-dihydro-1H-[1,4]oxazepino[2,3-c]quinolin-6-one (PubChem CID 170433637) has the molecular formula C18H19F2N3O4 and a molecular weight of 379.36 g/mol. Its IUPAC name is 2-cyclopropyl-3,3-difluoro-10-nitro-7-propan-2-yl-2,4-dihydro-1H-[1,4]oxazepino[2,3-c]quinolin-6-one.
| Compound Name | 2-cyclopropyl-3,3-difluoro-10-nitro-7-propan-2-yl-2,4-dihydro-1H-[1,4]oxazepino[2,3-c]quinolin-6-one |
|---|---|
| PubChem CID | 170433637 |
| Molecular Formula | C18H19F2N3O4 |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 2-cyclopropyl-3,3-difluoro-10-nitro-7-propan-2-yl-2,4-dihydro-1H-[1,4]oxazepino[2,3-c]quinolin-6-one |
| SMILES | CC(C)n1c(=O)c2c(c3cc([N+](=O)[O-])ccc31)NC(C1CC1)C(F)(F)CO2 |
| InChI | InChI=1S/C18H19F2N3O4/c1-9(2)22-13-6-5-11(23(25)26)7-12(13)14-15(17(22)24)27-8-18(19,20)16(21-14)10-3-4-10/h5-7,9-10,16,21H,3-4,8H2,1-2H3 |
| InChIKey | QUFKSHDNCMALTD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 86.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|