About [3-iodo-5-(2-methylsulfonylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol
[3-iodo-5-(2-methylsulfonylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol (PubChem CID 170434633) has the molecular formula C10H16IN3O3S
and a molecular weight of 385.23 g/mol. Its IUPAC name is [3-iodo-5-(2-methylsulfonylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol.
Molecular Properties
| Compound Name | [3-iodo-5-(2-methylsulfonylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol |
| PubChem CID | 170434633 |
| Molecular Formula | C10H16IN3O3S |
| Molecular Weight | 385.23 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | [3-iodo-5-(2-methylsulfonylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol |
| SMILES | CS(=O)(=O)CCN1CCn2nc(CO)c(I)c2C1 |
| InChI | InChI=1S/C10H16IN3O3S/c1-18(16,17)5-4-13-2-3-14-9(6-13)10(11)8(7-15)12-14/h15H,2-7H2,1H3 |
| InChIKey | BAFWAUXOWDUVLL-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.23 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [3-iodo-5-(2-methylsulfonylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-iodo-5-(2-methylsulfonylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol?
The IUPAC name of [3-iodo-5-(2-methylsulfonylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol (CID 170434633) is [3-iodo-5-(2-methylsulfonylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol.
What is the SMILES notation for [3-iodo-5-(2-methylsulfonylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol?
The canonical SMILES for [3-iodo-5-(2-methylsulfonylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol is CS(=O)(=O)CCN1CCn2nc(CO)c(I)c2C1.
What is the InChIKey of [3-iodo-5-(2-methylsulfonylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol?
The InChIKey is BAFWAUXOWDUVLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16IN3O3S/c1-18(16,17)5-4-13-2-3-14-9(6-13)10(11)8(7-15)12-14/h15H,2-7H2,1H3.
What are the key properties of [3-iodo-5-(2-methylsulfonylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol?
[3-iodo-5-(2-methylsulfonylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol has a molecular weight of 385.23 g/mol, XLogP of -0.16, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-iodo-5-(2-methylsulfonylethyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]methanol is sourced from PubChem (CID 170434633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).