C15H24O6S — CID 170434648
(2R,3S)-2-(1,3-dioxolan-2-ylmethyl)-6-(2-ethylsulfanyl-2-oxoethyl)-3-methyloxane-2-carboxylic acid (PubChem CID 170434648) has the molecular formula C15H24O6S and a molecular weight of 332.42 g/mol. Its IUPAC name is (2R,3S)-2-(1,3-dioxolan-2-ylmethyl)-6-(2-ethylsulfanyl-2-oxoethyl)-3-methyloxane-2-carboxylic acid.
| Compound Name | (2R,3S)-2-(1,3-dioxolan-2-ylmethyl)-6-(2-ethylsulfanyl-2-oxoethyl)-3-methyloxane-2-carboxylic acid |
|---|---|
| PubChem CID | 170434648 |
| Molecular Formula | C15H24O6S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (2R,3S)-2-(1,3-dioxolan-2-ylmethyl)-6-(2-ethylsulfanyl-2-oxoethyl)-3-methyloxane-2-carboxylic acid |
| SMILES | CCSC(=O)CC1CC[C@H](C)[C@](CC2OCCO2)(C(=O)O)O1 |
| InChI | InChI=1S/C15H24O6S/c1-3-22-12(16)8-11-5-4-10(2)15(21-11,14(17)18)9-13-19-6-7-20-13/h10-11,13H,3-9H2,1-2H3,(H,17,18)/t10-,11?,15+/m0/s1 |
| InChIKey | OHXKKKGVQAMGRN-ZYTVVRLJSA-N |
| XLogP | 2.06 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|