C17H18FN3O4S — CID 170434812
4-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-6-fluoro-1H-pyridin-2-one (PubChem CID 170434812) has the molecular formula C17H18FN3O4S and a molecular weight of 379.41 g/mol. Its IUPAC name is 4-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-6-fluoro-1H-pyridin-2-one.
| Compound Name | 4-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-6-fluoro-1H-pyridin-2-one |
|---|---|
| PubChem CID | 170434812 |
| Molecular Formula | C17H18FN3O4S |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 4-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-6-fluoro-1H-pyridin-2-one |
| SMILES | COc1cc2ncc(-c3cc(F)[nH]c(=O)c3)n2cc1S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C17H18FN3O4S/c1-17(2,3)26(23,24)13-9-21-11(8-19-15(21)7-12(13)25-4)10-5-14(18)20-16(22)6-10/h5-9H,1-4H3,(H,20,22) |
| InChIKey | SAMZLQHTWZANEC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|