About 6-(1,1-difluoro-2-methylpropan-2-yl)sulfonyl-7-methoxyimidazo[1,2-a]pyridine
6-(1,1-difluoro-2-methylpropan-2-yl)sulfonyl-7-methoxyimidazo[1,2-a]pyridine (PubChem CID 170434826) has the molecular formula C12H14F2N2O3S
and a molecular weight of 304.32 g/mol. Its IUPAC name is 6-(1,1-difluoro-2-methylpropan-2-yl)sulfonyl-7-methoxyimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 6-(1,1-difluoro-2-methylpropan-2-yl)sulfonyl-7-methoxyimidazo[1,2-a]pyridine |
| PubChem CID | 170434826 |
| Molecular Formula | C12H14F2N2O3S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 6-(1,1-difluoro-2-methylpropan-2-yl)sulfonyl-7-methoxyimidazo[1,2-a]pyridine |
| SMILES | COc1cc2nccn2cc1S(=O)(=O)C(C)(C)C(F)F |
| InChI | InChI=1S/C12H14F2N2O3S/c1-12(2,11(13)14)20(17,18)9-7-16-5-4-15-10(16)6-8(9)19-3/h4-7,11H,1-3H3 |
| InChIKey | HPJBVQLYPVVWCJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(1,1-difluoro-2-methylpropan-2-yl)sulfonyl-7-methoxyimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,1-difluoro-2-methylpropan-2-yl)sulfonyl-7-methoxyimidazo[1,2-a]pyridine?
The IUPAC name of 6-(1,1-difluoro-2-methylpropan-2-yl)sulfonyl-7-methoxyimidazo[1,2-a]pyridine (CID 170434826) is 6-(1,1-difluoro-2-methylpropan-2-yl)sulfonyl-7-methoxyimidazo[1,2-a]pyridine.
What is the SMILES notation for 6-(1,1-difluoro-2-methylpropan-2-yl)sulfonyl-7-methoxyimidazo[1,2-a]pyridine?
The canonical SMILES for 6-(1,1-difluoro-2-methylpropan-2-yl)sulfonyl-7-methoxyimidazo[1,2-a]pyridine is COc1cc2nccn2cc1S(=O)(=O)C(C)(C)C(F)F.
What is the InChIKey of 6-(1,1-difluoro-2-methylpropan-2-yl)sulfonyl-7-methoxyimidazo[1,2-a]pyridine?
The InChIKey is HPJBVQLYPVVWCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2N2O3S/c1-12(2,11(13)14)20(17,18)9-7-16-5-4-15-10(16)6-8(9)19-3/h4-7,11H,1-3H3.
What are the key properties of 6-(1,1-difluoro-2-methylpropan-2-yl)sulfonyl-7-methoxyimidazo[1,2-a]pyridine?
6-(1,1-difluoro-2-methylpropan-2-yl)sulfonyl-7-methoxyimidazo[1,2-a]pyridine has a molecular weight of 304.32 g/mol, XLogP of 2.16, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,1-difluoro-2-methylpropan-2-yl)sulfonyl-7-methoxyimidazo[1,2-a]pyridine is sourced from PubChem (CID 170434826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).