C23H23F3N4O2 — CID 170435583
12-(2,4-difluorophenyl)-7-fluoro-11-[1-(2-methoxyethyl)pyrrolidin-3-yl]-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one (PubChem CID 170435583) has the molecular formula C23H23F3N4O2 and a molecular weight of 444.46 g/mol. Its IUPAC name is 12-(2,4-difluorophenyl)-7-fluoro-11-[1-(2-methoxyethyl)pyrrolidin-3-yl]-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one.
| Compound Name | 12-(2,4-difluorophenyl)-7-fluoro-11-[1-(2-methoxyethyl)pyrrolidin-3-yl]-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one |
|---|---|
| PubChem CID | 170435583 |
| Molecular Formula | C23H23F3N4O2 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 12-(2,4-difluorophenyl)-7-fluoro-11-[1-(2-methoxyethyl)pyrrolidin-3-yl]-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one |
| SMILES | COCCN1CCC(C2Nc3cc(F)cc4c(=O)[nH]nc(c34)C2c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C23H23F3N4O2/c1-32-7-6-30-5-4-12(11-30)21-20(15-3-2-13(24)9-17(15)26)22-19-16(23(31)29-28-22)8-14(25)10-18(19)27-21/h2-3,8-10,12,20-21,27H,4-7,11H2,1H3,(H,29,31) |
| InChIKey | AWZSAVBLJPVSKM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |