C19H22FN3O4S — CID 170435729
5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3-fluoro-2-methoxyaniline (PubChem CID 170435729) has the molecular formula C19H22FN3O4S and a molecular weight of 407.47 g/mol. Its IUPAC name is 5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3-fluoro-2-methoxyaniline.
| Compound Name | 5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3-fluoro-2-methoxyaniline |
|---|---|
| PubChem CID | 170435729 |
| Molecular Formula | C19H22FN3O4S |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3-fluoro-2-methoxyaniline |
| SMILES | COc1cc2ncc(-c3cc(N)c(OC)c(F)c3)n2cc1S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C19H22FN3O4S/c1-19(2,3)28(24,25)16-10-23-14(9-22-17(23)8-15(16)26-4)11-6-12(20)18(27-5)13(21)7-11/h6-10H,21H2,1-5H3 |
| InChIKey | GMLMVPWEVACPRV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|