C22H22ClFN4O — CID 170436118
(11S,12S)-12-(2-chlorophenyl)-7-fluoro-11-(1-methylpiperidin-4-yl)-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one (PubChem CID 170436118) has the molecular formula C22H22ClFN4O and a molecular weight of 412.90 g/mol. Its IUPAC name is (11S,12S)-12-(2-chlorophenyl)-7-fluoro-11-(1-methylpiperidin-4-yl)-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one.
| Compound Name | (11S,12S)-12-(2-chlorophenyl)-7-fluoro-11-(1-methylpiperidin-4-yl)-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one |
|---|---|
| PubChem CID | 170436118 |
| Molecular Formula | C22H22ClFN4O |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (11S,12S)-12-(2-chlorophenyl)-7-fluoro-11-(1-methylpiperidin-4-yl)-2,3,10-triazatricyclo[7.3.1.05,13]trideca-1,5(13),6,8-tetraen-4-one |
| SMILES | CN1CCC([C@@H]2Nc3cc(F)cc4c(=O)[nH]nc(c34)[C@H]2c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C22H22ClFN4O/c1-28-8-6-12(7-9-28)20-19(14-4-2-3-5-16(14)23)21-18-15(22(29)27-26-21)10-13(24)11-17(18)25-20/h2-5,10-12,19-20,25H,6-9H2,1H3,(H,27,29)/t19-,20-/m0/s1 |
| InChIKey | MKHRJMRAFGSGPS-PMACEKPBSA-N |
| XLogP | 3.98 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |