About (3R,5S)-4-(4-chloro-2-methylphenyl)-3,5-dimethylpiperidin-4-ol
(3R,5S)-4-(4-chloro-2-methylphenyl)-3,5-dimethylpiperidin-4-ol (PubChem CID 170437243) has the molecular formula C14H20ClNO
and a molecular weight of 253.77 g/mol. Its IUPAC name is (3R,5S)-4-(4-chloro-2-methylphenyl)-3,5-dimethylpiperidin-4-ol.
Molecular Properties
| Compound Name | (3R,5S)-4-(4-chloro-2-methylphenyl)-3,5-dimethylpiperidin-4-ol |
| PubChem CID | 170437243 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | (3R,5S)-4-(4-chloro-2-methylphenyl)-3,5-dimethylpiperidin-4-ol |
| SMILES | Cc1cc(Cl)ccc1C1(O)[C@H](C)CNC[C@@H]1C |
| InChI | InChI=1S/C14H20ClNO/c1-9-6-12(15)4-5-13(9)14(17)10(2)7-16-8-11(14)3/h4-6,10-11,16-17H,7-8H2,1-3H3/t10-,11+,14? |
| InChIKey | LUDNVZRDGFPEND-BVUQATHDSA-N |
| XLogP | 2.71 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,5S)-4-(4-chloro-2-methylphenyl)-3,5-dimethylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5S)-4-(4-chloro-2-methylphenyl)-3,5-dimethylpiperidin-4-ol?
The IUPAC name of (3R,5S)-4-(4-chloro-2-methylphenyl)-3,5-dimethylpiperidin-4-ol (CID 170437243) is (3R,5S)-4-(4-chloro-2-methylphenyl)-3,5-dimethylpiperidin-4-ol.
What is the SMILES notation for (3R,5S)-4-(4-chloro-2-methylphenyl)-3,5-dimethylpiperidin-4-ol?
The canonical SMILES for (3R,5S)-4-(4-chloro-2-methylphenyl)-3,5-dimethylpiperidin-4-ol is Cc1cc(Cl)ccc1C1(O)[C@H](C)CNC[C@@H]1C.
What is the InChIKey of (3R,5S)-4-(4-chloro-2-methylphenyl)-3,5-dimethylpiperidin-4-ol?
The InChIKey is LUDNVZRDGFPEND-BVUQATHDSA-N. The full InChI is InChI=1S/C14H20ClNO/c1-9-6-12(15)4-5-13(9)14(17)10(2)7-16-8-11(14)3/h4-6,10-11,16-17H,7-8H2,1-3H3/t10-,11+,14?.
What are the key properties of (3R,5S)-4-(4-chloro-2-methylphenyl)-3,5-dimethylpiperidin-4-ol?
(3R,5S)-4-(4-chloro-2-methylphenyl)-3,5-dimethylpiperidin-4-ol has a molecular weight of 253.77 g/mol, XLogP of 2.71, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5S)-4-(4-chloro-2-methylphenyl)-3,5-dimethylpiperidin-4-ol is sourced from PubChem (CID 170437243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).