About 8-(difluoromethyl)-6-(2,6-difluorophenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one
8-(difluoromethyl)-6-(2,6-difluorophenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one (PubChem CID 170437583) has the molecular formula C15H9F4N3OS
and a molecular weight of 355.32 g/mol. Its IUPAC name is 8-(difluoromethyl)-6-(2,6-difluorophenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 8-(difluoromethyl)-6-(2,6-difluorophenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one |
| PubChem CID | 170437583 |
| Molecular Formula | C15H9F4N3OS |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 8-(difluoromethyl)-6-(2,6-difluorophenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one |
| SMILES | CSc1ncc2c(=O)n(-c3c(F)cccc3F)cc(C(F)F)c2n1 |
| InChI | InChI=1S/C15H9F4N3OS/c1-24-15-20-5-7-11(21-15)8(13(18)19)6-22(14(7)23)12-9(16)3-2-4-10(12)17/h2-6,13H,1H3 |
| InChIKey | YVQSONXQSKEGOU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-(difluoromethyl)-6-(2,6-difluorophenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(difluoromethyl)-6-(2,6-difluorophenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one?
The IUPAC name of 8-(difluoromethyl)-6-(2,6-difluorophenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one (CID 170437583) is 8-(difluoromethyl)-6-(2,6-difluorophenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one.
What is the SMILES notation for 8-(difluoromethyl)-6-(2,6-difluorophenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one?
The canonical SMILES for 8-(difluoromethyl)-6-(2,6-difluorophenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one is CSc1ncc2c(=O)n(-c3c(F)cccc3F)cc(C(F)F)c2n1.
What is the InChIKey of 8-(difluoromethyl)-6-(2,6-difluorophenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one?
The InChIKey is YVQSONXQSKEGOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9F4N3OS/c1-24-15-20-5-7-11(21-15)8(13(18)19)6-22(14(7)23)12-9(16)3-2-4-10(12)17/h2-6,13H,1H3.
What are the key properties of 8-(difluoromethyl)-6-(2,6-difluorophenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one?
8-(difluoromethyl)-6-(2,6-difluorophenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one has a molecular weight of 355.32 g/mol, XLogP of 3.72, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(difluoromethyl)-6-(2,6-difluorophenyl)-2-methylsulfanylpyrido[4,3-d]pyrimidin-5-one is sourced from PubChem (CID 170437583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).