C19H19N7O4Zn — CID 170438089
6-(1-carbamoylcyclopropyl)-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]pyridazine-3-carboxylic acid;zinc (PubChem CID 170438089) has the molecular formula C19H19N7O4Zn and a molecular weight of 474.80 g/mol. Its IUPAC name is 6-(1-carbamoylcyclopropyl)-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]pyridazine-3-carboxylic acid;zinc.
| Compound Name | 6-(1-carbamoylcyclopropyl)-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]pyridazine-3-carboxylic acid;zinc |
|---|---|
| PubChem CID | 170438089 |
| Molecular Formula | C19H19N7O4Zn |
| Molecular Weight | 474.80 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 6-(1-carbamoylcyclopropyl)-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]pyridazine-3-carboxylic acid;zinc |
| SMILES | COc1c(Nc2cc(C3(C(N)=O)CC3)nnc2C(=O)O)cccc1-c1ncn(C)n1.[Zn] |
| InChI | InChI=1S/C19H19N7O4.Zn/c1-26-9-21-16(25-26)10-4-3-5-11(15(10)30-2)22-12-8-13(19(6-7-19)18(20)29)23-24-14(12)17(27)28;/h3-5,8-9H,6-7H2,1-2H3,(H2,20,29)(H,22,23)(H,27,28); |
| InChIKey | HWABSMIJPBEMJH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 158.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.80 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|