C35H45N7O4 — CID 170438705
4-[4-[4-[(10S)-4-[2-(methoxymethoxy)phenyl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]piperidin-1-yl]piperidin-1-yl]-2-methylbenzoic acid (PubChem CID 170438705) has the molecular formula C35H45N7O4 and a molecular weight of 627.79 g/mol. Its IUPAC name is 4-[4-[4-[(10S)-4-[2-(methoxymethoxy)phenyl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]piperidin-1-yl]piperidin-1-yl]-2-methylbenzoic acid.
| Compound Name | 4-[4-[4-[(10S)-4-[2-(methoxymethoxy)phenyl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]piperidin-1-yl]piperidin-1-yl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 170438705 |
| Molecular Formula | C35H45N7O4 |
| Molecular Weight | 627.79 g/mol |
| Exact Mass | 627.35 |
| IUPAC Name | 4-[4-[4-[(10S)-4-[2-(methoxymethoxy)phenyl]-1,5,6,8,12-pentazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-12-yl]piperidin-1-yl]piperidin-1-yl]-2-methylbenzoic acid |
| SMILES | COCOc1ccccc1-c1cc2c(nn1)NC[C@H]1CN(C3CCN(C4CCN(c5ccc(C(=O)O)c(C)c5)CC4)CC3)CCN21 |
| InChI | InChI=1S/C35H45N7O4/c1-24-19-27(7-8-29(24)35(43)44)40-15-9-25(10-16-40)39-13-11-26(12-14-39)41-17-18-42-28(22-41)21-36-34-32(42)20-31(37-38-34)30-5-3-4-6-33(30)46-23-45-2/h3-8,19-20,25-26,28H,9-18,21-23H2,1-2H3,(H,36,38)(H,43,44)/t28-/m0/s1 |
| InChIKey | ZYPKUCDODJUZLE-NDEPHWFRSA-N |
| XLogP | 4.18 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.79 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|