C21H25F3N2O3 — CID 170439619
(3S,7aS,11aR)-3-propan-2-yl-9-[[4-(trifluoromethyl)phenyl]methyl]-3,6,7,7a,10,11-hexahydro-2H-[1,3]oxazolo[2,3-j][1,6]naphthyridine-5,8-dione (PubChem CID 170439619) has the molecular formula C21H25F3N2O3 and a molecular weight of 410.44 g/mol. Its IUPAC name is (3S,7aS,11aR)-3-propan-2-yl-9-[[4-(trifluoromethyl)phenyl]methyl]-3,6,7,7a,10,11-hexahydro-2H-[1,3]oxazolo[2,3-j][1,6]naphthyridine-5,8-dione.
| Compound Name | (3S,7aS,11aR)-3-propan-2-yl-9-[[4-(trifluoromethyl)phenyl]methyl]-3,6,7,7a,10,11-hexahydro-2H-[1,3]oxazolo[2,3-j][1,6]naphthyridine-5,8-dione |
|---|---|
| PubChem CID | 170439619 |
| Molecular Formula | C21H25F3N2O3 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (3S,7aS,11aR)-3-propan-2-yl-9-[[4-(trifluoromethyl)phenyl]methyl]-3,6,7,7a,10,11-hexahydro-2H-[1,3]oxazolo[2,3-j][1,6]naphthyridine-5,8-dione |
| SMILES | CC(C)[C@H]1CO[C@]23CCN(Cc4ccc(C(F)(F)F)cc4)C(=O)[C@H]2CCC(=O)N13 |
| InChI | InChI=1S/C21H25F3N2O3/c1-13(2)17-12-29-20-9-10-25(19(28)16(20)7-8-18(27)26(17)20)11-14-3-5-15(6-4-14)21(22,23)24/h3-6,13,16-17H,7-12H2,1-2H3/t16-,17-,20-/m1/s1 |
| InChIKey | XWTNGCUZQISTDB-MBOZVWFJSA-N |
| XLogP | 3.43 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |