About methyl 2-[4,4-dimethoxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxyacetate
methyl 2-[4,4-dimethoxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxyacetate (PubChem CID 170439631) has the molecular formula C18H24F3NO5
and a molecular weight of 391.39 g/mol. Its IUPAC name is methyl 2-[4,4-dimethoxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxyacetate.
Molecular Properties
| Compound Name | methyl 2-[4,4-dimethoxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxyacetate |
| PubChem CID | 170439631 |
| Molecular Formula | C18H24F3NO5 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | methyl 2-[4,4-dimethoxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxyacetate |
| SMILES | COC(=O)COC1CN(Cc2ccc(C(F)(F)F)cc2)CCC1(OC)OC |
| InChI | InChI=1S/C18H24F3NO5/c1-24-16(23)12-27-15-11-22(9-8-17(15,25-2)26-3)10-13-4-6-14(7-5-13)18(19,20)21/h4-7,15H,8-12H2,1-3H3 |
| InChIKey | GNEJLBNJXHFLTN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[4,4-dimethoxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4,4-dimethoxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxyacetate?
The IUPAC name of methyl 2-[4,4-dimethoxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxyacetate (CID 170439631) is methyl 2-[4,4-dimethoxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxyacetate.
What is the SMILES notation for methyl 2-[4,4-dimethoxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxyacetate?
The canonical SMILES for methyl 2-[4,4-dimethoxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxyacetate is COC(=O)COC1CN(Cc2ccc(C(F)(F)F)cc2)CCC1(OC)OC.
What is the InChIKey of methyl 2-[4,4-dimethoxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxyacetate?
The InChIKey is GNEJLBNJXHFLTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24F3NO5/c1-24-16(23)12-27-15-11-22(9-8-17(15,25-2)26-3)10-13-4-6-14(7-5-13)18(19,20)21/h4-7,15H,8-12H2,1-3H3.
What are the key properties of methyl 2-[4,4-dimethoxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxyacetate?
methyl 2-[4,4-dimethoxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxyacetate has a molecular weight of 391.39 g/mol, XLogP of 2.46, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4,4-dimethoxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-3-yl]oxyacetate is sourced from PubChem (CID 170439631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).