About methyl 2-[(3-hydroxy-1,4,7-trimethyl-2-oxoindol-3-yl)methyl]prop-2-enoate
methyl 2-[(3-hydroxy-1,4,7-trimethyl-2-oxoindol-3-yl)methyl]prop-2-enoate (PubChem CID 170439770) has the molecular formula C16H19NO4
and a molecular weight of 289.33 g/mol. Its IUPAC name is methyl 2-[(3-hydroxy-1,4,7-trimethyl-2-oxoindol-3-yl)methyl]prop-2-enoate.
Molecular Properties
| Compound Name | methyl 2-[(3-hydroxy-1,4,7-trimethyl-2-oxoindol-3-yl)methyl]prop-2-enoate |
| PubChem CID | 170439770 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | methyl 2-[(3-hydroxy-1,4,7-trimethyl-2-oxoindol-3-yl)methyl]prop-2-enoate |
| SMILES | C=C(CC1(O)C(=O)N(C)c2c(C)ccc(C)c21)C(=O)OC |
| InChI | InChI=1S/C16H19NO4/c1-9-6-7-10(2)13-12(9)16(20,15(19)17(13)4)8-11(3)14(18)21-5/h6-7,20H,3,8H2,1-2,4-5H3 |
| InChIKey | FRMBWCZCNUDYAW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(3-hydroxy-1,4,7-trimethyl-2-oxoindol-3-yl)methyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(3-hydroxy-1,4,7-trimethyl-2-oxoindol-3-yl)methyl]prop-2-enoate?
The IUPAC name of methyl 2-[(3-hydroxy-1,4,7-trimethyl-2-oxoindol-3-yl)methyl]prop-2-enoate (CID 170439770) is methyl 2-[(3-hydroxy-1,4,7-trimethyl-2-oxoindol-3-yl)methyl]prop-2-enoate.
What is the SMILES notation for methyl 2-[(3-hydroxy-1,4,7-trimethyl-2-oxoindol-3-yl)methyl]prop-2-enoate?
The canonical SMILES for methyl 2-[(3-hydroxy-1,4,7-trimethyl-2-oxoindol-3-yl)methyl]prop-2-enoate is C=C(CC1(O)C(=O)N(C)c2c(C)ccc(C)c21)C(=O)OC.
What is the InChIKey of methyl 2-[(3-hydroxy-1,4,7-trimethyl-2-oxoindol-3-yl)methyl]prop-2-enoate?
The InChIKey is FRMBWCZCNUDYAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO4/c1-9-6-7-10(2)13-12(9)16(20,15(19)17(13)4)8-11(3)14(18)21-5/h6-7,20H,3,8H2,1-2,4-5H3.
What are the key properties of methyl 2-[(3-hydroxy-1,4,7-trimethyl-2-oxoindol-3-yl)methyl]prop-2-enoate?
methyl 2-[(3-hydroxy-1,4,7-trimethyl-2-oxoindol-3-yl)methyl]prop-2-enoate has a molecular weight of 289.33 g/mol, XLogP of 1.59, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3-hydroxy-1,4,7-trimethyl-2-oxoindol-3-yl)methyl]prop-2-enoate is sourced from PubChem (CID 170439770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).