C10H16N2 — CID 170440614
4,6,7-trimethyl-3a,4,7,7a-tetrahydro-1H-benzimidazole (PubChem CID 170440614) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 4,6,7-trimethyl-3a,4,7,7a-tetrahydro-1H-benzimidazole.
| Compound Name | 4,6,7-trimethyl-3a,4,7,7a-tetrahydro-1H-benzimidazole |
|---|---|
| PubChem CID | 170440614 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 4,6,7-trimethyl-3a,4,7,7a-tetrahydro-1H-benzimidazole |
| SMILES | CC1=CC(C)C2N=CNC2C1C |
| InChI | InChI=1S/C10H16N2/c1-6-4-7(2)9-10(8(6)3)12-5-11-9/h4-5,7-10H,1-3H3,(H,11,12) |
| InChIKey | GMLFVBGOWSOPHR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|