C56H34O4 — CID 170440758
2,10-bis(3,5-diphenylphenyl)chromeno[2,3-a]xanthene-8,14-dione (PubChem CID 170440758) has the molecular formula C56H34O4 and a molecular weight of 770.88 g/mol. Its IUPAC name is 2,10-bis(3,5-diphenylphenyl)chromeno[2,3-a]xanthene-8,14-dione.
| Compound Name | 2,10-bis(3,5-diphenylphenyl)chromeno[2,3-a]xanthene-8,14-dione |
|---|---|
| PubChem CID | 170440758 |
| Molecular Formula | C56H34O4 |
| Molecular Weight | 770.88 g/mol |
| Exact Mass | 770.25 |
| IUPAC Name | 2,10-bis(3,5-diphenylphenyl)chromeno[2,3-a]xanthene-8,14-dione |
| SMILES | O=c1c2cc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)ccc2oc2c1ccc1oc3ccc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)cc3c(=O)c12 |
| InChI | InChI=1S/C56H34O4/c57-54-47-23-26-52-53(55(58)49-34-40(21-24-50(49)59-52)46-31-43(37-17-9-3-10-18-37)28-44(32-46)38-19-11-4-12-20-38)56(47)60-51-25-22-39(33-48(51)54)45-29-41(35-13-5-1-6-14-35)27-42(30-45)36-15-7-2-8-16-36/h1-34H |
| InChIKey | FUVJQGOZZZVCIQ-UHFFFAOYSA-N |
| XLogP | 14.21 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.88 |
| LogP ≤ 5 | 14.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|