C17H25NO3 — CID 170441037
2-[(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)methyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 170441037) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-[(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)methyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)methyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 170441037 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-[(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)methyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CON1C(C)(C)CC(CC2=CC(=O)C=CC2=O)CC1(C)C |
| InChI | InChI=1S/C17H25NO3/c1-16(2)10-12(11-17(3,4)18(16)21-5)8-13-9-14(19)6-7-15(13)20/h6-7,9,12H,8,10-11H2,1-5H3 |
| InChIKey | ZMMKRPVCVKFSQS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|