C6H11O8P — CID 170441291
5-dihydroxyphosphanyloxy-2,3-dihydroxy-2-methyl-4-oxopentanoic acid (PubChem CID 170441291) has the molecular formula C6H11O8P and a molecular weight of 242.12 g/mol. Its IUPAC name is 5-dihydroxyphosphanyloxy-2,3-dihydroxy-2-methyl-4-oxopentanoic acid.
| Compound Name | 5-dihydroxyphosphanyloxy-2,3-dihydroxy-2-methyl-4-oxopentanoic acid |
|---|---|
| PubChem CID | 170441291 |
| Molecular Formula | C6H11O8P |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 5-dihydroxyphosphanyloxy-2,3-dihydroxy-2-methyl-4-oxopentanoic acid |
| SMILES | CC(O)(C(=O)O)C(O)C(=O)COP(O)O |
| InChI | InChI=1S/C6H11O8P/c1-6(11,5(9)10)4(8)3(7)2-14-15(12)13/h4,8,11-13H,2H2,1H3,(H,9,10) |
| InChIKey | LGYFJDURSHLOKQ-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|