C56H35N5O — CID 170441483
6-[4-(4-dibenzofuran-4-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-1,3,4-triphenylbenzo[g]indazole (PubChem CID 170441483) has the molecular formula C56H35N5O and a molecular weight of 793.93 g/mol. Its IUPAC name is 6-[4-(4-dibenzofuran-4-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-1,3,4-triphenylbenzo[g]indazole.
| Compound Name | 6-[4-(4-dibenzofuran-4-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-1,3,4-triphenylbenzo[g]indazole |
|---|---|
| PubChem CID | 170441483 |
| Molecular Formula | C56H35N5O |
| Molecular Weight | 793.93 g/mol |
| Exact Mass | 793.28 |
| IUPAC Name | 6-[4-(4-dibenzofuran-4-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]-1,3,4-triphenylbenzo[g]indazole |
| SMILES | c1ccc(-c2nc(-c3ccc(-c4cccc5c4oc4ccccc45)cc3)nc(-c3cccc4c3cc(-c3ccccc3)c3c(-c5ccccc5)nn(-c5ccccc5)c34)n2)cc1 |
| InChI | InChI=1S/C56H35N5O/c1-5-17-36(18-6-1)47-35-48-44(52-50(47)51(38-19-7-2-8-20-38)60-61(52)41-23-11-4-12-24-41)27-16-29-46(48)56-58-54(39-21-9-3-10-22-39)57-55(59-56)40-33-31-37(32-34-40)42-26-15-28-45-43-25-13-14-30-49(43)62-53(42)45/h1-35H |
| InChIKey | CIOXJPJHPQWYOI-UHFFFAOYSA-N |
| XLogP | 14.27 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.93 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |